The incorrect equation for Solvay process is -

1. Ca(OH)2+2NH4ClNH3+2H2O+CaCl2

2. 2NaHCO3Na2CO3+CO2+H2O

3. 2NaCl+CaCO3Na2CO3+CaCl2

4. None of the above.

Subtopic:  Compounds of Ca and Na -Preparations, Properties & Uses |
Level 3: 35%-60%
Hints
Links

Potassium carbonate cannot be prepared by the Solvay process because -

1. Potassium carbonate is insoluble in water and does not precipitate out.
2. Potassium carbonate is soluble in water and does not precipitate out.
3. Potassium carbonate is soluble in water and does precipitate out.
4. Potassium carbonate is insoluble in water and does precipitate out.

Subtopic:  Compounds of Ca and Na -Preparations, Properties & Uses |
 75%
Level 2: 60%+
Hints
Links

The hydroxides and carbonates of sodium and potassium are easily soluble in water while the corresponding salts of magnesium and calcium are sparingly soluble in water because -

1. Lattice energies of carbonates and hydroxides formed by calcium and magnesium are much more than those of sodium and potassium.

2. Lattice energies of carbonates and hydroxides formed by sodium and potassium are much more than those of calcium and magnesium.

3. Enthalpy of carbonates and hydroxides formed by calcium and magnesium are much more than those of sodium and potassium.

4. Enthalpy of carbonates and hydroxides formed by sodium and potassium are much more than those of calcium and magnesium.

Subtopic:  Reasoning Questions | Compounds of Ca and Na -Preparations, Properties & Uses |
 69%
Level 2: 60%+
Hints

advertisementadvertisement

Lithium salts are generally hydrated because they have :

1. High polarizing power.

2. High ionization enthalpy.

3. High electronegativity.

4. Low polarizing power.

Subtopic:  Physical Properties | Chemical Properties |
 74%
Level 2: 60%+
Hints
Links

LiF is almost insoluble in water whereas LiCl is soluble in water and acetone both, because of:

1. Greater covalent character of LiCl as compared to LiF.
2. Greater hydration energy of  LiF as compared to LiCl.
3. Greater size of LiF as compared to LiCl.
4. Greater lattice energy of LiF as compared to LiCl.

 

Subtopic:  Chemical Properties | Reasoning Questions |
 57%
Level 3: 35%-60%
Hints

The incorrect reaction among the following is:

1. Na2O2(s) + 2H2O(l) → 2NaOH(aq) + H2O2(g)
2. 2KO2(s) + 2H2O(l) → 2KOH(aq) + H2O2(aq) + O2(g)
3. Na2O(s) + CO2(g) → NaHCO3 (s) + H2O2(aq)
4. Na2O(s) + CO2(g) → Na2CO3 (s)

Subtopic:  Chemical Properties | Compounds of Ca and Na -Preparations, Properties & Uses |
 69%
Level 2: 60%+
Hints

advertisementadvertisement

The incorrect statement among the following regarding alkaline earth metals is : 

1. Alkaline earth metals are silvery-white, lustrous, and harder than alkali metals.
2. Only Ca, Sr, Mg, and Ba give a flame test.
3. Alkaline earth metals have high electrical, and thermal conductivities.
4. All alkaline earth metals react with halogen and form metal halides, with the general formula  MX2 .

Subtopic:  Physical Properties |
 75%
Level 2: 60%+
Hints

The incorrect statement among the following is-

1. Ionisation enthalpy of alkaline earth metals is higher than alkali metals.
2. Alkaline earth metal oxides are more basic than alkali metal oxides.
3. Alkaline earth metal hydroxides are less basic and less stable than alkali metal hydroxides.
4. Solubility of Alkaline earth metals and alkali metal hydroxide increases down the group.

Subtopic:  Physical Properties |
 70%
Level 2: 60%+
Hints

Why can alkali and alkaline earth metals not be obtained by chemical reduction methods?

1. They are a strong reducing agent

2. They are a strong oxidizing agent

3. Their compounds are nonreactive in nature.

4. None of these

 

 

Subtopic:  Preparations, Properties & Uses of S Block Elements |
 85%
Level 1: 80%+
Hints

advertisementadvertisement

premium feature crown icon
Unlock IMPORTANT QUESTION
This question was bookmarked by 5 NEET 2025 toppers during their NEETprep journey. Get Target Batch to see this question.
✨ Perfect for quick revision & accuracy boost
Buy Target Batch
Access all premium questions instantly

The incorrect statement among the following is -

1. The thermal stability of nitrates of groups 1 and 2 increases down the group.
2. Nitrates of both groups 1 and 2 are insoluble in water.
3. The solubility of alkali metal carbonates increases down the group.
4. The solubility of alkaline earth metals sulphates decreases down the group.

Subtopic:  Chemical Properties |
Level 3: 35%-60%
Hints