Saline hydrides can remove traces of water from organic compounds because :

1. They react with water to form a metal hydroxide along with the liberation of oxygen gas.
2. They react with water to form a metal hydroxide along with the liberation of hydrogen gas.
3. They react with water to form a metal carbonate along with the liberation of oxygen gas.
4. They react with water to form a metal carbonate along with the liberation of hydrogen gas.

Subtopic:  Type of Hydride |
 79%
Level 2: 60%+
Hints

H2O2 behave as a bleaching agent because :

1. It acts as a strong oxidizing agent both in acidic and basic media.
2. It acts as a strong reducing agent both in acidic and basic media.
3. It acts as a strong oxidizing agent only in neutral media.
4. It acts as a strong reducing agent only in neutral media.

Subtopic:  H2O2 (Hydrogen Peroxide) |
 75%
Level 2: 60%+
Hints

A colourless liquid 'A' contains H and O elements only. It decomposes slowly on exposure to light. It is stabilised by mixing urea to store in the presence of light. The chemical equation for its decomposition reaction in light is-

1.  H2O2sunlighthvH2O+O3

2. 2H2O2sunlighthv2H2O+O2

3. 2H2O2sunlighthv2H2O+H2

4.  2H2O2sunlighthvNORxn

Subtopic:  H2O2 (Hydrogen Peroxide) |
 83%
Level 1: 80%+
Hints

advertisementadvertisement

The catalyst used to increase the production of H, by ‘coal gasification' process is -

1. Copper 

2. FeCr2O4 (iron chromate) 

3. Pd/C 

4. None of the above.

Subtopic:  Hydrogen- Types & Isotopes |
 67%
Level 2: 60%+
Hints
Links

Hydrogen is placed separately in the periodic table because : 

1. It resembles alkali metals.

2. It shows the same reactions as halogens.

3. Both (1) and (2)

4. None of the above.

Subtopic:  Hydrogen- Types & Isotopes |
 92%
Level 1: 80%+
Hints
Links

NH3 is an example of :

1. Electron rich hydride

2. Electron-precise hydride

3. Electron deficient hydride

4. None of the above

Subtopic:  Type of Hydride |
 77%
Level 2: 60%+
Hints

advertisementadvertisement

Incorrect statement regarding structure of H2O and H2O2 is:

1. In gaseous phase, water molecule has a bent form.

2. Bond angle of water is 109.0°

3. Hydrogen peroxide has a non-planar structure.

4. The dihedral angle of H2Oin gas phase is 111.5° 

Subtopic:  Water | H2O2 (Hydrogen Peroxide) |
 70%
Level 2: 60%+
Hints

The reaction that is not an example of a hydrolysis reaction is-

1. PbS(s)+H2O2(aq)PbSO4(s)+H2O(l)

2. CaO(s)+H2O(g)Ca(OH)2(aq)

3. AlCl3(g)+3H2O(l)Al2O3(s)+6HCl(aq)

4. Ca3N2(s)+6H2O(l)3Ca(OH)2(aq)+2NH3(g)

Subtopic:  Water |
 63%
Level 2: 60%+
Hints

The following reaction is an example of :

\(2 \mathrm{MnO}_4^{-}+6 \mathrm{H}^{+}+5 \mathrm{H}_2 \mathrm{O}_2 \rightarrow 2 \mathrm{Mn}^{2+}+8 \mathrm{H}_2 \mathrm{O}+5 \mathrm{O}_2\)

1. Hydrolysis reaction

2. Redox reaction

3. Disproportionation reaction

4. None of the above

Subtopic:  Preparation & Properties | H2O2 (Hydrogen Peroxide) |
 67%
Level 2: 60%+
Hints
Links

advertisementadvertisement

The reaction in which hydrogen peroxide acts as a reducing agent is/are-

1. Mn+2+H2O2Mn+4+2OH-

2. PbS+4H2O2PbSO4+4H2O

3. I2+H2O2+2OH-2I-+2H2O+O2

4. All of the above

Subtopic:  H2O2 (Hydrogen Peroxide) |
 65%
Level 2: 60%+
Hints