The catalyst used in the manufacture of polythene by the Ziegler method is:

1. titanium tetrachloride and triphenyl aluminum

2. titanium tetrachloride and triethyl aluminium

3. titanium dioxide

4. titanium isopropoxide

त्सीग्लर विधि द्वारा पॉलिथीन के निर्माण में उपयोग किया जाने वाला उत्प्रेरक है:

1. टाइटेनियम टेट्राक्लोराइड और ट्राइफेनिल ऐलुमिनियम

2. टाइटेनियम टेट्राक्लोराइड और ट्राइएथिल ऐलुमिनियम

3. टाइटेनियम डाइऑक्साइड

4. टाइटेनियम आइसोप्रोपॉक्साइड

Level 3: 35%-60%

To unlock all the explanations of this course, you need to be enrolled.

Hints

Melamine plastic crockery is a copolymer of:

1. HCHO and melamine

2. HCHO and ethylene

3. melamine and ethylene

4. none of the above

मेलामाइन प्लास्टिक क्रॉकरी किसका एक सहबहुलक है?

1. HCHO और मेलामाइन

2. HCHO और एथिलीन

3. मेलामाइन और एथिलीन

4. उपरोक्त में से कोई नहीं

Level 3: 35%-60%

To unlock all the explanations of this course, you need to be enrolled.

Hints

Which one of the following is an example of a thermosetting polymer ?

1. 

2. 

3. 

4. 

निम्नलिखित में से कौन सा तापद्रढ़ बहुलक का एक उदाहरण है?

Level 4: Below 35%

To unlock all the explanations of this course, you need to be enrolled.

Hints

advertisementadvertisement

Which one of the following polymers prepared by condensation polymerization?

1. Nylon-66

2. Teflon

3. Rubber

4. Polystyrene

निम्नलिखित में से कौन सा बहुलक संघनन बहुलकीकरण द्वारा निर्मित किया जाता है?

(a) नाइलॉन-66

(b) टेफ्लॉन

(c) रबर

(d) स्टाइरीन

 66%
Level 2: 60%+

To unlock all the explanations of this course, you need to be enrolled.

Hints

Bakelite is prepared by the reaction between

1. urea and formaldehyde

2. ethylene glycol

3. phenol and formaldehyde

4. tetramethylene glycol

किसके मध्य की अभिक्रिया द्वारा बैकेलाइट का निर्माण किया जाता है?

1. यूरिया और फार्मेल्डिहाइड 

2. एथिलीन ग्लाइकॉल  

3. फिनॉल और फार्मेल्डिहाइड 

4. टेट्रामेथिलीन ग्लाइकॉल 

 70%
Level 2: 60%+

To unlock all the explanations of this course, you need to be enrolled.

Hints

Acetate rayon is prepared from:

(1) acetic acid

(2) glycerol

(3) starch

(4) cellulose

एसीटेट रेऑन किससे निर्मित किया गया है:

(1) एसीटिक अम्ल 

(2) ग्लिसरॉल

(3) स्टार्च

(4) सेलुलोज 

Level 4: Below 35%

To unlock all the explanations of this course, you need to be enrolled.

Hints

advertisementadvertisement

Nylon-6,6 is a polyamide obtained by the reaction of

1. COOH(CH2)4COOH+H2NC6H4NH2-(p)

2. COOH(CH2)4COOH+NH2(CH2)6NH2

3. COOH(CH2)4COOH+NH2(CH2)4NH2

4. COOHC6H4COOH-(p)+NH2(CH2)6NH2

नाइलॉन-66 एक पॉलिऐमाइड किसकी अभिक्रिया से प्राप्त होता है?

(a) COOH(CH2)4COOH+H2NC6H4NH2-(p)

(b) COOH(CH2)4COOH+NH2(CH2)6NH2

(c) COOH(CH2)4COOH+NH2(CH2)4NH2

(d) COOHC6H4COOH-(p)+NH2(CH2)6NH2

 58%
Level 3: 35%-60%

To unlock all the explanations of this course, you need to be enrolled.

Hints

Natural silk and artificial silk differ in one respect that one of them contains:

(1) N                     

(2) S

(3) P                       

(4) none of these

प्राकृतिक रेशम और कृत्रिम रेशम एक संदर्भ में भिन्न होते हैं जिनमें से एक में होता है:

(1 ) N 

(2) S 

(3) P

(4) इनमें से कोई नहीं

Level 4: Below 35%

To unlock all the explanations of this course, you need to be enrolled.

Hints

Structures of some common polymers are given. Which one is not correctly presented?

कुछ सामान्य बहुलकों की संरचनाएँ दी गई हैं। कौन सी सही ढंग से प्रदर्शित नहीं की गई है?

*Teflon - टेफ्लॉन

*Neoprene - निओप्रीन

*Terylene - टेरिलीन

*Nylon 66 - नाइलॉन 66

Level 3: 35%-60%

To unlock all the explanations of this course, you need to be enrolled.

Hints

advertisementadvertisement

Which of these is not a monomer for a high molecular mass silicone polymer?

1. MeSiCl3

2. Me2SiCl2

3. Me3SiCl

4. PhSiCl3

निम्नलिखित में कौन उच्च अणु द्रव्यमान वाले सिलिकॉन बहुलक के लिए एक एकलक नहीं है?

1. MeSiCl3

2. Me2SiCl2

3. Me3SiCl

4. PhSiCl3

Level 3: 35%-60%

To unlock all the explanations of this course, you need to be enrolled.

Hints