Which of these is not a monomer for a high molecular mass silicone polymer?

1. MeSiCl3

2. Me2SiCl2

3. Me3SiCl

4. PhSiCl3

निम्नलिखित में कौन उच्च अणु द्रव्यमान वाले सिलिकॉन बहुलक के लिए एक एकलक नहीं है?

1. MeSiCl3

2. Me2SiCl2

3. Me3SiCl

4. PhSiCl3

Level 3: 35%-60%

To unlock all the explanations of this course, you need to be enrolled.

Hints

Which of the following structures represents neoprene polymer?

1.

2.

3.

4.

निम्नलिखित में से कौन सी संरचना निओप्रीन बहुलक को निरूपित करती है?

(a)

(b)

(c)

(d)

 64%
Level 2: 60%+

To unlock all the explanations of this course, you need to be enrolled.

Hints

-NHCH26NHCOCH24CO-n is a

1. copolymer

2. additional polymer

3. thermo-setting polymer

4. homopolymer

1. सह बहुलक 

2. अतिरिक्त बहुलक 

3. ताप दृढ़ बहुलक 

4. सम बहुलक 

 58%
Level 3: 35%-60%

To unlock all the explanations of this course, you need to be enrolled.

Hints

advertisementadvertisement

Example of addition polymer is:

1. buna-S

2. bakelite

3. nylon-6

4. malamac

योगज बहुलक का उदाहरण है:

(a) ब्यूना-S 

(b) बैकेलाइट

(c) नाइलॉन-6

(d) मैलामेक 

Level 3: 35%-60%

To unlock all the explanations of this course, you need to be enrolled.

Hints

The abbreviation PDI refers to:

(1) name of the polymer

(2) polydispersity index of polymer

(3) application of polymer

(4) poly diagonal index

PDI संक्षिप्त में क्या संदर्भित करता है?

(1) बहुलक का नाम

(2) बहुलक का बहुपरिक्षेपित संकेत 

(3) बहुलक का अनुप्रयोग

(4) बहु विकर्ण सूचकांक

 56%
Level 3: 35%-60%

To unlock all the explanations of this course, you need to be enrolled.

Hints

Structures of some common polymers are given. Which one is not correctly presented?

कुछ सामान्य बहुलकों की संरचनाएँ दी गई हैं। कौन सी सही ढंग से प्रदर्शित नहीं की गई है?

*Teflon - टेफ्लॉन

*Neoprene - निओप्रीन

*Terylene - टेरिलीन

*Nylon 66 - नाइलॉन 66

Level 3: 35%-60%

To unlock all the explanations of this course, you need to be enrolled.

Hints

advertisementadvertisement

Natural silk and artificial silk differ in one respect that one of them contains:

(1) N                     

(2) S

(3) P                       

(4) none of these

प्राकृतिक रेशम और कृत्रिम रेशम एक संदर्भ में भिन्न होते हैं जिनमें से एक में होता है:

(1 ) N 

(2) S 

(3) P

(4) इनमें से कोई नहीं

Level 4: Below 35%

To unlock all the explanations of this course, you need to be enrolled.

Hints

Nylon-6,6 is a polyamide obtained by the reaction of

1. COOH(CH2)4COOH+H2NC6H4NH2-(p)

2. COOH(CH2)4COOH+NH2(CH2)6NH2

3. COOH(CH2)4COOH+NH2(CH2)4NH2

4. COOHC6H4COOH-(p)+NH2(CH2)6NH2

नाइलॉन-66 एक पॉलिऐमाइड किसकी अभिक्रिया से प्राप्त होता है?

(a) COOH(CH2)4COOH+H2NC6H4NH2-(p)

(b) COOH(CH2)4COOH+NH2(CH2)6NH2

(c) COOH(CH2)4COOH+NH2(CH2)4NH2

(d) COOHC6H4COOH-(p)+NH2(CH2)6NH2

 58%
Level 3: 35%-60%

To unlock all the explanations of this course, you need to be enrolled.

Hints

Acetate rayon is prepared from:

(1) acetic acid

(2) glycerol

(3) starch

(4) cellulose

एसीटेट रेऑन किससे निर्मित किया गया है:

(1) एसीटिक अम्ल 

(2) ग्लिसरॉल

(3) स्टार्च

(4) सेलुलोज 

Level 4: Below 35%

To unlock all the explanations of this course, you need to be enrolled.

Hints

advertisementadvertisement

Bakelite is prepared by the reaction between

1. urea and formaldehyde

2. ethylene glycol

3. phenol and formaldehyde

4. tetramethylene glycol

किसके मध्य की अभिक्रिया द्वारा बैकेलाइट का निर्माण किया जाता है?

1. यूरिया और फार्मेल्डिहाइड 

2. एथिलीन ग्लाइकॉल  

3. फिनॉल और फार्मेल्डिहाइड 

4. टेट्रामेथिलीन ग्लाइकॉल 

 70%
Level 2: 60%+

To unlock all the explanations of this course, you need to be enrolled.

Hints