If solubility product of Ca(OH)2is10-11, the pH at which Ca(OH)2 precipitate from a solution containing decimolar concentration of Ca2+ is
Which of the following pH conditions is required for Ca(OH)₂ to start precipitating from a 0.1 M Ca²⁺ solution given that its solubility product is 10⁻¹¹?

1. pH <5

2. 9<pH<5

3. pH>9

4. 7<pH>9

Subtopic:  Solubility Product |
 57%
Level 3: 35%-60%
Hints

For the reaction,

CuSO4.5H2O(s)CuSO4.3H2O(s)+2H2O(g)

choose the correct representation:

1. KP=PH2O2

2. Kc = [H2O]2

3. KP=KC(RT)2

4. All of the above

Subtopic:  Introduction To Equilibrium |
 85%
Level 1: 80%+
Hints

The solubility of PbCI2  in water is  0.01 M  at  25 °C. The maximum concentration of Pb2+ in 0.1 M NaCI will be:

1. 2×10-3 M

2. 1×10-4 M

3. 1.6×10-2 M

4. 4×10-4 M

Subtopic:  Solubility Product |
 60%
Level 2: 60%+
Hints

advertisementadvertisement

 Find the percentage hydrolysis of NaCN in a 0.1 M solution if the pH of the solution is 11.

1. 0.1%

2. 1.0%

3. 0.01%

4. 10%

Subtopic:  Salt Hydrolysis & Titration |
 54%
Level 3: 35%-60%
Hints

How much water should be added to 400 mL of HCI solution in order to raise the pH by one unit?

1. 360 mL 2. 1000 mL
3. 600 mL 4. 3600 mL
Subtopic:  pH calculation |
 55%
Level 3: 35%-60%
Hints

Find the degree of dissociation of N₂O₄ at 100°C corresponding to vapour density 24.5:

1. 80%

2. 87.75%

3. 40.34%

4. 60%

Subtopic:  Kp, Kc & Factors Affecting them |
 75%
Level 2: 60%+
Hints

advertisementadvertisement

For the equilibrium  SO2CI2(g) ⇌ SO2(g) + CI2(g)  volume is increased.
When the equilibrium is re-established then: 

1. amount of  SO2(g)  will decrease

2. amount of  SO2CI2(g)  will increase

3. amount of CI2(g)  will increase

4. amount of CI2(g) will remain unchanged

Subtopic:  Le Chatelier's principle |
 64%
Level 2: 60%+
Hints

In the reaction A(g) + 2B(g) ⇌ 2C(g) + D(g), the initial concentration of B is twice that of A and, at equilibrium, the concentrations of A and D are equal. The value of the equilibrium constant will be:

1. 4 2. 16
3. 2 4. 1
Subtopic:  Introduction To Equilibrium |
 69%
Level 2: 60%+
Hints
Links

Consider the given reaction: 2HIH2+I2 
At 22% dissociation of HI, what would be the value of equilibrium constant?

1. 0.04

2. 0.0198

3. 0.5

4. 1.2527

Subtopic:  Introduction To Equilibrium |
 74%
Level 2: 60%+
Hints

advertisementadvertisement

The degree of hydrolysis of the salt is independent of the concentration of a solution: 
1. NH4CI
2. NH4CN
3. (NH4)2SO4
4. All of the above

Subtopic:  Salt Hydrolysis & Titration |
 63%
Level 2: 60%+
Hints
Links