-NHCH26NHCOCH24CO-n is a -
1. Copolymer.
2. Addition polymer.
3. Thermo-setting polymer.
4. Homopolymer.
Other Reason
Nylon-6,6 is a polyamide obtained by the reaction of
1. COOH(CH2)4COOH+H2NC6H4NH2-(p)
2. COOH(CH2)4COOH+NH2(CH2)6NH2
3. COOH(CH2)4COOH+NH2(CH2)4NH2
4. COOHC6H4COOH-(p)+NH2(CH2)6NH2
Which one is protein fibre ?
1. Cotton
2. Rayon
3. Silk
4. Polyster
Terylene is a condensation polymer of ethylene glycol and
1. Benzoic acid
2. Phthalic acid
3. Salicylic acid
4. Terephthalic acid
The polymer that can be classified as polyster polymer is :
1. Bakelite
2. Melamine
3. Nylon-66
4. Terylene
© 2025 GoodEd Technologies Pvt. Ltd.