Which of the following statements are correct about the mechanism of this reaction?
(i) | A carbocation will be formed as an intermediate in the reaction. |
(ii) | OH– will attach the substrate (b) from one side and Cl– will leave it simultaneously from other side. |
(iii) | An unstable intermediate will be formed in which OH– and Cl– will be attached by weak bonds. |
(iv) | Reaction proceeds through SN1 mechanism |
Choose the correct option
1. (i, ii)
2. (ii, iii)
3. (iii, iv)
4. (i, iv)
Which of the following statements is correct about the kinetics of the above-given reaction?
(i). | The rate of reaction depends on the concentration of only (b). |
(ii). | The rate of reaction depends on the concentration of both (a) and (b). |
(iii). | Molecularity of reaction is one. |
(iv). | Molecularity of reaction is two. |
Choose the correct option
1. | (i, ii) | 2. | (ii, iii) |
3. | (iii, iv) | 4. | (i, iii) |
Haloalkanes contain halogen atom(s) attached to the sp3 hybridized carbon atom of an alkyl group. Identify haloalkanes from the following compounds:
(a) | 2-Bromopentane | (b) | Vinyl chloride (chloroethene) |
(c) | 2-Chloroacetophenone | (d) | Trichloromethane |
1. | (a, b) | 2. | (b, c) |
3. | (c, d) | 4. | (a, d) |
Which of the following statements about the isomers ethylene dichloride and ethylidene chloride are correct?
a. | Both the compounds form the same product on treatment with alcoholic KOH. |
b. | Both the compounds form the same product on treatment with aq. NaOH. |
c. | Both the compounds form the same product on reduction. |
d. | Both compounds are optically active. |
Choose the correct option:
1. a and b
2. b and c
3. c and d
4. a and c
Which of the following compounds are gem-dihalides?
(a) Ethylidene chloride
(b) Ethylene dichloride
(c) Methylene chloride
(d) Benzyl chloride
Choose the correct option:
1. | (a, b) | 2. | (b, c) |
3. | (c, d) | 4. | (a, c) |
Which of the following are secondary bromides?
(i) (CH3)2CHBr
(ii) (CH3)3CCH2Br
(iii) CH3CH(Br)CH2CH3
(iv) (CH3)2CBrCH2CH3
Choose the correct option
1. (i, ii)
2. (ii, iii)
3. (iii, iv)
4. (i, iii)
Which of the following compounds can be classified as aryl halides?
(i) p-ClC6H4CH2CH(CH3)2
(ii) p-CH3CHCl(C6H4)CH2CH3
(iii) o-BrH2C-C6H4CH(CH3)CH2CH3
(iv) C6H5-Cl
Choose the correct option
1. (i, ii)
2. (ii, iii)
3. (iii, iv)
4. (i, iv)
Alkyl halides are prepared from alcohols by treating with:
i. HCl + ZnCl2
ii. Red P + Br2
iii. H2SO4 + KI
iv. All of the above
Choose the correct option:
1. (i, ii)
2. (ii, iii)
3. (iii, iv)
4. (i, iii)
Alkyl fluorides are synthesized by alkyl chloride/bromide in presence of ........ or .......
(a) CaF2
(b) CoF2
(c) Hg2F2
(d) NaF
Choose the correct option
1. (a, b)
2. (b, c)
3. (c, d)
4. (a, d)
The statements regarding the reaction intermediate are given below.
i. | Intermediate (c) is unstable because in this carbon is attached to 5 atoms. |
ii. | Intermediate (c) is unstable because carbon atom is sp2 hybridised. |
iii. | Intermediate (c) is stable because carbon atom is sp2 hybridised. |
iv. | Intermediate (c) is less stable than the reactant (b). |
The correct statements are:
1. (i, ii)
2. (ii, iii)
3. (iii, iv)
4. (i, iv)