Benzene reacts with CH3Cl in the presence of anhy. AlCl3 to form

1. toluene

2. chlorobenzene

3. benzylchloride

4. xylene

 

बेंजीन किसके निर्माण के लिए निर्जल AlCl3 की उपस्थिति में CH3Cl के साथ अभिक्रिया करता है? 

1. टॉलूईन 

2. क्लोरोबेंजीन

3. बेंज़िलक्लोराइड

4. जाइलीन 

 

 55%

To unlock all the explanations of this course, you need to be enrolled.

Hints

Alkynes can be reduced to alkenes by hydrogenation in presence of:

1. raney Ni                             

2. anhy. AlCl3

3. Pd                                       

4. Lindlar's catalyst

किसकी उपस्थिति में हाइड्रोजनीकरण द्वारा एल्कीन को एल्काइन में अपचयित किया जा सकता है?

1. रैने Ni     

2. निर्जल AlCl3

3. Pd         

4. लिंडलर उत्प्रेरक

To unlock all the explanations of this course, you need to be enrolled.

Hints

What is the end product of the following sequences of operations?

         CaC2H2OAHg2+Dil.H2SO4H2NiC

1. Methyl alcohol                              2. Acetaldehyde

3. C2H5OH                                      4. C2H4

प्रचालनों के निम्नलिखित अनुक्रमों का अंतिम उत्पाद क्या है?

CaC2H2OAHg2+तनु H2SO4H2NiC

1. मेथिल एल्कोहॉल   2. ऐसीटैल्डिहाइड

3. C2H5OH         4. C2H4

To unlock all the explanations of this course, you need to be enrolled.

Hints

advertisementadvertisement

In Wurtz reaction if we take CH3Cl & C2H5Cl then product, will be-

1. Propane + Ethane                                                 

2. Propane

3. Propane + Ethane + Butane                                  

4. Propane + Butane

 

वुर्ट्ज़ अभिक्रिया में यदि हम CH3Cl और C2H5Cl लेते हैं, तब उत्पाद, क्या होगा?

1. प्रोपेन + एथेन

2. प्रोपेन

3. प्रोपेन + एथेन + ब्यूटेन

4. प्रोपेन + ब्यूटेन

 62%

To unlock all the explanations of this course, you need to be enrolled.

Hints

Which of the following compounds can be best prepared by Wurtz-reaction ?

1. Iso-butane

2. n-butane

3. n-pentane

4. Iso-pentane

 

निम्नलिखित में से कौन सा यौगिक वुर्ट्ज़-अभिक्रिया द्वारा निर्मित किया जा सकता है?

1. आइसो-ब्यूटेन

2. n-ब्यूटेन

3. n-पेंटेन

4. आइसो-पेंटेन

 70%

To unlock all the explanations of this course, you need to be enrolled.

Hints

When acetylene is passed through dil. H2SO4 in presence of HgSO4, the compound formed is

1. ether                                    2. ketone

3. acetic acid                             4. acetaldehyde

जब एसीटिलीन को HgSO4 की उपस्थिति में तनु H2SO4 में से गुजारा जाता है, तो निर्मित यौगिक है-

1. ईथर              2. कीटोन

3. एसीटिक अम्ल  4. ऐसीटैल्डिहाइड

 63%

To unlock all the explanations of this course, you need to be enrolled.

Hints

advertisementadvertisement

CH3-CH2-CH2-CCH+LiHN2(A)(CH3)2SO4(B)

Give the structural formula of compound (B):

1. CH3-(CH2)2-CC-SO3H

2. CH3-(CH2)2-CC-CH3

3.  CH3-(CH2)2-CC-CH2-O-OsO-H

4. CH3-CH2-CC-CH2

 

CH3-CH2-CH2-CCH+LiHN2(A)(CH3)2SO4(B)

यौगिक (B) का संरचनात्मक सूत्र दीजिए:

1. CH3-(CH2)2-CC-SO3H

2. CH3-(CH2)2-CC-CH3

3.  CH3-(CH2)2-CC-CH2-O-OsO-H

4. CH3-CH2-CC-CH2

To unlock all the explanations of this course, you need to be enrolled.

Hints

Predict the correct intermediate and product in the following reaction.

H3C-CCH HgSO4H2O, H2SO4 Intermediate Product

                                        (A)                   (B)

1. 

2. 

3. 

4. 

 

निम्नलिखित अभिक्रिया में सही मध्यवर्ती और उत्पाद अनुमानित कीजिए।

H3C-CCH HgSO4H2O, H2SO4 मध्यवर्ती  उत्पाद

                                      (A)            (B)

1. 

2. 

3. 

4. 

 53%

To unlock all the explanations of this course, you need to be enrolled.

Hints

Octane no. of a fuel can be increased by:

(a) isomerism                               (b) alkylation

(c) reforming                                (d) all of these

 एक ईंधन की ऑक्टेन संख्या किसके द्वारा बढ़ायी जा सकती है?

(a) समावयवता    (b) ऐल्किलन

(c) पुन: निर्माण    (d) ये सभी 

To unlock all the explanations of this course, you need to be enrolled.

Hints

advertisementadvertisement

 

The compound most likely to decolourise a solution of
alkaline KMnO4 is –

 (A) CH3 CH3                                               (B)  C10H8

(C) (CH3)4C                                                    (D) CH3CH = CHCH2CH2CH3

जो क्षारीय KMnO4 के विलयन को विरंजित करता है, वह संभावित यौगिक है? 

 (A) CH3 CH3      (B) C10H8

(C) (CH3)4C           (D) CH3CH = CHCH2CH2CH3

 50%

To unlock all the explanations of this course, you need to be enrolled.

Hints