Compound P(C6H10) does not have any geometrical isomer. ON ozonolysis, two products R(C3H4O) and Q(C3H6O) are formed. R gives negative iodoform test while Q responds positively towards I2/NaOH solution. S, another isomer of P is an unsyumetrical alkene and on ozonolysis produces T(C6H10O2) which also gives a yellow precipitate with I2/NaOH solution and also gives positive test with Tollen's reagent. Which of the following does not represent any of the molecules amongst P,Q,R,S & T.

(1)  
(2)
(3)
(4)

यौगिक P(C6H10) के पास कोई ज्यामितीय समावयवी नहीं है। ओजोनोपघटन पर, दो उत्पाद R(C3H4O) और Q(C3H6O) निर्मित होते हैं। R ऋणात्मक आयोडोफॉर्म परीक्षण देता है जबकि Q, I2/NaOH विलयन के प्रति धनात्मक अभिक्रिया देता है। S, P का एक और समावयवी एक असममित एल्कीन है और ओजोनोपघटन पर T (C6H10O2) निर्मित करता है जो I2/NaOH विलयन के साथ एक पीला अवक्षेप देता है और टॉलेन अभिकर्मक के साथ धनात्मक परीक्षण भी देता है। निम्नलिखित में से कौन P, Q, R, S और T के मध्य किसी भी अणुओं का प्रतिनिधित्व नहीं करता है।

(1)  
(2)
(3)
(4)

Level 4: Below 35%

To unlock all the explanations of this course, you need to be enrolled.

Hints

The most appropriate major product of the followning sequence of reactions would be

(1)
(2)
(3)
(4)

अभिक्रियाओं के निम्नलिखित अनुक्रम का सबसे उपयुक्त मुख्य उत्पाद होगा?

(1)
(2)
(3)
(4)

Level 4: Below 35%

To unlock all the explanations of this course, you need to be enrolled.

Hints

CH3CC.CH3(ii)H2O/Zn(i)XCH3-C-C-CH3||||OO

In the above reaction X is:

(a) HNO3                                (b) O2

(c) O3                                     (d) KMnO4

CH3CC.CH3(ii)H2O/Zn(i)X

उपरोक्त अभिक्रिया में X है:

(a) HNO3      (b) O2

(c) O3           (d) KMnO4

 62%
Level 2: 60%+

To unlock all the explanations of this course, you need to be enrolled.

Hints

advertisementadvertisement

 (Ibuprofen)

Ibuprofen is:

 

Clemmensen reduction-क्लीमेन्सन अपचयन

(आइबुप्रोफ़ेन)

आइबुप्रोफ़ेन है:

 

Level 3: 35%-60%

To unlock all the explanations of this course, you need to be enrolled.

Hints

In Friedel-Craft's alkylation, besides AlCl3 the other reactants are                             

1. C6H6 + NH2

2. C6H6 + CH4

3. C6H6 + CH3Cl

4. C6H6 + CH3COCl

फ्रीडेल-क्राफ्ट ऐल्किलन में, AlClके अतिरिक्त अन्य अभिकारक हैं?

1. C6H6 + NH2

2. C6H6 + CH4

3. C6H6 + CH3Cl

4. C6H6 + CH3COCl

 77%
Level 2: 60%+

To unlock all the explanations of this course, you need to be enrolled.

Hints

The product obtained on heating n-heptane with Cr2O3-Al2O3 at 600°C is

1. cyclohexane                               2. cyclohexene

3. benzene                                    4. toluene

n-हेप्टेन को Cr2O3-Al2O3 के साथ 600°C पर गर्म करने पर प्राप्त उत्पाद है?  

1. साइक्लोहेक्सेन   2. साइक्लोहेक्सीन 

3. बेंजीन             4. टॉलूईन 

 53%
Level 3: 35%-60%

To unlock all the explanations of this course, you need to be enrolled.

Hints

advertisementadvertisement

The compound X in the reaction.

+ICl+anhydrousAlCl3X

1.   2. 

3.          4. 

अभिक्रिया में यौगिक X क्या है?

+ICl+    निर्जल    AlCl3X

1.   2. 

3. 4.

Level 3: 35%-60%

To unlock all the explanations of this course, you need to be enrolled.

Hints

Nitrobenzene can be prepared from benzene by using a mixture of conc HNO3 and conc.

H2SO4. In the mixture, nitric acid acts as a/an:

1. reducing agent

2. acid

3. base

4. catalyst

नाइट्रोबेंजीन को बेंजीन से सांद्र HNOऔर सांद्र H2SO4 के मिश्रण का उपयोग कर निर्मित किया जा सकता है।मिश्रण में, नाइट्रिक अम्ल किस रूप में कार्य करता है? 

(a) अपचायक 

(b) अम्ल 

(c)  क्षार 

(d) उत्प्रेरक

 50%
Level 3: 35%-60%

To unlock all the explanations of this course, you need to be enrolled.

Hints

CHCHO3/NaOHXZn/CH3COOHY. Y is:

1. CH2OH-CH2OH                         2. CH3CH2OH

3. CH3COOH                                 4. CH3OH

CHCHO3/NaOHXZn/CH3COOHY, Y क्या है?

1. CH2OH-CH2OH   2.CH3CH2OH

3. CH3COOH            4.CH3OH

Level 4: Below 35%

To unlock all the explanations of this course, you need to be enrolled.

Hints

advertisementadvertisement

R-CH2-CCl2-RReagentR-CC-R. The reagent is

1. Na                                     2. HCl in H2O

3. KOH in C2H5OH                 4. Zn in alcohol 

R-CH2-CCl2-Rअभिकर्मकR-CC-R, अभिकर्मक है?

1. Na                        2. H2O में HCl 

3. C2H5OH में KOH    4. एल्कोहॉल में Zn

 67%
Level 2: 60%+

To unlock all the explanations of this course, you need to be enrolled.

Hints