Which of the following acid is most easily decarboxylate :-

(1)

(2)

(3)

(4)

निम्नलिखित में से कौन सा अम्ल सबसे आसानी से विकार्बोक्सिलीकृत होता है:- 

(1)

(2)

(3)

(4)

Level 4: Below 35%

To unlock all the explanations of this course, you need to be enrolled.

Hints

The compound which on reduction with LiAlH4 gives two diffrent alcohols:

1. CH3COOCH3                         

2.  CH3COOC2H5

3. CH3COCH3                           

4.  CH3CHO

यौगिक जो LiAlH4 के साथ अपचयन पर दो भिन्न एल्कोहॉल देता है:

1. CH3COOCH3

2. CH3COOC2H5

3. CH3COCH3  

4. CH3CHO

Level 4: Below 35%

To unlock all the explanations of this course, you need to be enrolled.

Hints

CH3-cCHdil.H2SO4HgSO4(A)

CH3-cCH(2)H2SO4/HO-(1)BH3THF(B)

Product (A) and (B) is differentiated by:

1. 2-4 DNP

2. NaOI

3. Na-metal

4. NaHSO3

CH3-cCHतनु H2SO4HgSO4(A)

CH3-cCH(2)H2SO4/HO-(1)BH3THF(B)

उत्पाद (A) और (B) द्वारा विभेदित किया जाता है:

1. 2-4 DNP

2. NaOI

3. Na-धातु 

4. NaHSO3

Level 4: Below 35%

To unlock all the explanations of this course, you need to be enrolled.

Hints

advertisementadvertisement

The end products of following reaction would be,

(1)  
(2)
(3)
(4)

निम्नलिखित अभिक्रिया के अंतिम उत्पाद होंगे,

(1)  
(2)
(3)
(4)

Level 4: Below 35%

To unlock all the explanations of this course, you need to be enrolled.

Hints

Which statement about the aldol condensation is correct ?

1. A Lewis acid is commonly used as a catalyst

2. The initial step is probably the formation of a carbanion

3. A Lewis base is employed to induce carbocation formation 

4. The carbon chain is lengthened through the elimination of 1 mole of water

एल्डोल संघनन के बारे में कौन सा कथन सही है?

1. एक लुईस अम्ल सामान्यत: उत्प्रेरक के रूप में उपयोग किया जाता है

2. प्रारंभिक पद संभवतः एक कार्बऋणायन का निर्माण है

3. एक लुईस अम्ल को कार्बधनायन निर्माण को प्रेरित करने के लिए उपयोग किया जाता है

4. कार्बन श्रृंखला को 1 मोल जल के विलोपन के माध्यम से लंबा किया जाता है

Level 4: Below 35%

To unlock all the explanations of this course, you need to be enrolled.

Hints

The compound A gives following reactions.

Its structure can be

(1)  
(2)
(3)
(4)

यौगिक A निम्नलिखित अभिक्रियाएँ देता है।

इसकी संरचना हो सकती है

(1)  
(2)
(3)
(4)

Level 4: Below 35%

To unlock all the explanations of this course, you need to be enrolled.

Hints

advertisementadvertisement

Reactant (A) and (B) is:

1. Ph-CH2-CH=O + NH2-OH

2. Ph-CH=O + NH2-OH

3. Ph-CllO-CH3 + NH2-NH2

4. Ph-CllO-CH3 + NH2-OH

अभिकारक (A) और (B) है:

1. Ph-CH2-CH=O + NH2-OH

2. Ph-CH=O + NH2-OH

3. Ph-CllO-CH3 + NH2-NH2

4. Ph-CllO-CH3 + NH2-OH

Level 4: Below 35%

To unlock all the explanations of this course, you need to be enrolled.

Hints

Ph-ClOH-CH3PCC(A)NH2-NH-CO-NH2(B)

Product (B) is :

1. Ph-ClCH3=N-NH-CllO-NH2

2. Ph-ClCH3=N-CllO-NH-NH2

3. Ph-CH=N-NlCH3-CllO-NH2

4. Ph-ClCH3=N-CllO-NH-NH2

Ph-ClOH-CH3PCCANH2-NH-CO-NH2B

उत्पाद (B) है:

1. Ph-ClCH3=N-CllO-NH-NH2

2. Ph-ClCH3=N-CllO-NH-NH2

3. Ph-CH=N-NlCH3-CllO-NH2

4. Ph-ClCH3=N-CllO-NH-NH2

Level 4: Below 35%

To unlock all the explanations of this course, you need to be enrolled.

Hints

 

Ph-CH3CrO2Cl2(A)conc.KOHPh-CH2OH+(B)

Product (B) of above the raction is :

1. Ph-CO2H

2. Ph-CO2-

3. Ph-CHO

4. Ph-CH3

 

Ph-CH3CrO2Cl2(A)सांद्र KOHPh-CH2OH+(B)

उपरोक्त अभिक्रिया का उत्पाद (B) है:

1. Ph-CO2H

2. Ph-CO2-

3. Ph-CHO

4. Ph-CH3

Level 4: Below 35%

To unlock all the explanations of this course, you need to be enrolled.

Hints

advertisementadvertisement

Above compounds can be differentiated by following reagent:

1. 2-4 DNP (Brady reagent)

2. Tollen's reagent

3. Bromine water reagent

4. NaHSO3

उपरोक्त यौगिकों को निम्नलिखित अभिकर्मक द्वारा विभेदित किया जा सकता है:

1. 2-4 DNP (ब्रैडी अभिकर्मक)

2. टॉलेन अभिकर्मक

3. ब्रोमीन जल अभिकर्मक

4. NaHSO3

Level 4: Below 35%

To unlock all the explanations of this course, you need to be enrolled.

Hints