For the equilibrium, PQ(g)P(g)+Q(g) at 300 K. The pressure at which 50% of PQ is dissociated is numerically equal to :

1. 3 Kp

2. 4Kp

3. Kp

4. Can't be predicted

Subtopic:  Kp, Kc & Factors Affecting them |
 60%
Level 2: 60%+
Hints


Find the number of moles of PCl₅ required in a 3.0 L flask to obtain a Cl₂ concentration of 0.15 M, given that Kc for the reaction PCl₅(g) ⇌ PCl₃(g) + Cl₂(g) is 0.04 at 25°C.

1. 1.5 mole

2. 2.1 mole

3. 6.0 mole

4. 0.45 mole

Subtopic:  Introduction To Equilibrium |
 51%
Level 3: 35%-60%
Hints

For the following reaction, 
 H2(g)+I2(g)2HI(g) at 250°C,

The effect on the state of equilibrium on doubling the volume of the system will be:

1. Shift to the reactant side 2. Shift to the product side 
3. No effect on the state of equilibrium 4. Liquefaction of HI

Subtopic:  Le Chatelier's principle |
 85%
Level 1: 80%+
Hints
Links

advertisementadvertisement

Which of the following cannot act as a buffer? 
1. NaH2PO4 + H3PO4
2. NH4OH + NH4CI
3. NaOH + CH3COONa
4. Both (1) & (3)

Subtopic:  Buffer |
 54%
Level 3: 35%-60%
Hints
Links

If solubility product of Ca(OH)2is10-11, the pH at which Ca(OH)2 precipitate from a solution containing decimolar concentration of Ca2+ is
Which of the following pH conditions is required for Ca(OH)₂ to start precipitating from a 0.1 M Ca²⁺ solution given that its solubility product is 10⁻¹¹?

1. pH <5

2. 9<pH<5

3. pH>9

4. 7<pH>9

Subtopic:  Solubility Product |
 57%
Level 3: 35%-60%
Hints

For the reaction,

CuSO4.5H2O(s)CuSO4.3H2O(s)+2H2O(g)

choose the correct representation:

1. KP=PH2O2

2. Kc = [H2O]2

3. KP=KC(RT)2

4. All of the above

Subtopic:  Introduction To Equilibrium |
 86%
Level 1: 80%+
Hints

advertisementadvertisement

The solubility of PbCI2  in water is  0.01 M  at  25 °C. The maximum concentration of Pb2+ in 0.1 M NaCI will be:

1. 2×10-3 M

2. 1×10-4 M

3. 1.6×10-2 M

4. 4×10-4 M

Subtopic:  Solubility Product |
 60%
Level 2: 60%+
Hints

 Find the percentage hydrolysis of NaCN in a 0.1 M solution if the pH of the solution is 11.

1. 0.1%

2. 1.0%

3. 0.01%

4. 10%

Subtopic:  Salt Hydrolysis & Titration |
 54%
Level 3: 35%-60%
Hints

How much water should be added to 400 mL of HCI solution in order to raise the pH by one unit?

1. 360 mL 2. 1000 mL
3. 600 mL 4. 3600 mL
Subtopic:  pH calculation |
 55%
Level 3: 35%-60%
Hints

advertisementadvertisement

Find the degree of dissociation of N₂O₄ at 100°C corresponding to vapour density 24.5:

1. 80%

2. 87.75%

3. 40.34%

4. 60%

Subtopic:  Kp, Kc & Factors Affecting them |
 75%
Level 2: 60%+
Hints