2 mole of an ideal monoatomic gas undergoes a reversible process for which PV2=C. The gas is expanded from initial volume of 1 L to final volume of 3 L starting from initial temperature of 300 K. Find H for the process:

1.  -600 R

2.  -1000 R

3.  -3000 R

4.  None of these

Subtopic:  Enthalpy & Internal energy |
 60%
Level 2: 60%+
Hints

Calculate S for 3 mole of a diatomic ideal gas which is heated and compressed from 298 K and 1 bar to 596 K and 4 bar: [Given: Cv, m (gas)=52 R;  ln (2)=0.70;  R=2 cal k-1 mol-1]

1.  -14.7 cal K-1

2.  +14.7 cal K-1

3.  -6.9 cal K-1

4.  6.3 cal K-1

Subtopic:  Spontaneity & Entropy |
Level 3: 35%-60%
Hints

For the hypothetical reaction
                                    A2g+B2g2ABg
rGandrS are 20 kJ/mol and -20 JK-1 mol-1 respectively at 200 K.
If rCP is 20 JK-1 mol-1 then rH at 400 K is:

1.  20 kJ/mol

2.  7.98 kJ/mol

3.  28 kJ/mol

4.  None of these

Subtopic:  Enthalpy & Internal energy |
Level 3: 35%-60%
Hints

advertisementadvertisement

Calculate fH° (in kJ/mol) for Cr2O3 from the rG° and the S° values provided at 27°C

\(\begin{array}{ll} 4 C r(s)+3 O_2(g) \rightarrow 2 C r_2 O_3(s), \\ \Delta_r G^{\circ}=-2093.4 k J / m o l \\ S^{\circ}(\mathrm{J} / / \mathrm{K} \mathrm{~mol}): S^{\circ}(C r, s)=24, \\ S^{\circ}\left(O_2, g\right)=205, \quad S^{\circ}\left(C r_2 O_3, s\right)=81 \end{array}\)

1.  -2258.1 kJ/mol
2.  -1129.05 kJ/mol
3.  -964.35 kJ/mol
4.  None of the above

Subtopic:  Gibbs Energy Change |
Level 3: 35%-60%
Hints
Links

A gas Cv,m=52R behaving ideally was allowed to expand reversibly and adiabatically from 1 litre to 32 litre. It's initial temperature was 327°C. The molar enthalpy change (in J/mol) for the process is:

1.  -1125 R

2.  -675

3.  -1575 R

4.  None of these

Subtopic:  First Law of Thermodynamics |
 57%
Level 3: 35%-60%
Hints

2.1 g of Fe combines with S evolving 3.77 kJ. The heat of the formation of FeS in kJ/mole is:

1. – 3.77 2. – 1.79
3. – 100.5 4. None of these
Subtopic:  Enthalpy & Internal energy |
 52%
Level 3: 35%-60%
Hints

advertisementadvertisement

The bond energy of H—H and Cl-Cl is 430 kJ
mol-1 and 240 kJ mol-1 respectively and ΔHf for HCl is -90 kJ mol-1. The bond enthalpy of HCl is:

1. 290 kJ mol-1

2. 380 kJ mol-1

3. 425 kJ mol-1

4. 245 kJ mol-1

Subtopic:  Thermochemistry |
 63%
Level 2: 60%+
AIPMT - 2007
Hints
Links

Boron can undergo the following reactions with the given enthalpy changes: 2B(s)

2Bs+32O2B2O2s;H=-1260kJ
2Bs+3H2B2H6s;H=30kJ

Assume no other reactions are occurring. If in a container (operating at constant pressure) which is isolated from the surrounding, a mixture of H2(gas) and O2 (gas) is passed over excess of B(s), then calculate the molar ratio (O2;H2) so that the temperature of the container does not change :

1. 15:3

2. 42:1

3. 1:42

4. 1:84

Subtopic:  Enthalpy & Internal energy |
Level 3: 35%-60%
Hints

Consider the reaction at 300 K C6H6(l)+152O2(g)6CO2(g)+3H2O(I);(H)=-3271kJ. What is AU for the combustion of 1.5 moles of benzene at 27°C

1. -3267.25 kJ

2. -4900.88 kJ

3. -4906.5 kJ

4. -3274.75 kJ

Subtopic:  First Law of Thermodynamics |
Level 3: 35%-60%
Hints

advertisementadvertisement

A gas expands against a variable pressure given by P = 20/V (where P in atm and V in L). During expansion from the volume of 1 liter to 10 liters, the gas undergoes a change in internal energy of 400 J. How much heat is absorbed by the gas during expansion?

1. 46 J

2. 4660 J

3. 5065.8 J

4. 4260 J

Subtopic:  2nd & 3rd Law of Thermodynamics |
 54%
Level 3: 35%-60%
Hints