A suitable reagent for the reaction below is:

1. \(BH_3 /THF , \ H_2O_2 /OH^{-} ~then~ PCC \)
2. \(H_3O^+ , then ~PCC \)
3. PCC oxidation 
4. \(BH_3/THF , HIO_4 \)
Subtopic:  Alcohols: Preparation & Properties |
 77%
Level 2: 60%+
Please attempt this question first.
Hints
Please attempt this question first.

Among the following reactions, the reaction will not form acetaldehyde is:

1. CH3CH2OH573KCu

2. CH3CN(ii)H2O(i)DIBALH

3. CH2=CH2+O2H2OPd(II)/Cu(II)

4. CH3CH2OHCrO3-H2SO4

Subtopic:  Alcohols: Preparation & Properties |
 52%
Level 3: 35%-60%
Please attempt this question first.
Hints
Please attempt this question first.

Identify A in the given reaction:

1. 2.
3. 4.
Subtopic:  Alcohols: Preparation & Properties |
 62%
Level 2: 60%+
Please attempt this question first.
Hints
Please attempt this question first.

advertisementadvertisement

What will be the major product (P) in the following reaction?
1. 2.
3. 4.
Subtopic:  Alcohols: Preparation & Properties |
 82%
Level 1: 80%+
Please attempt this question first.
Hints
Please attempt this question first.

Consider the following reaction:
 
What is the major product P?
1. 2.
3. 4.
Subtopic:  Alcohols: Preparation & Properties |
Level 3: 35%-60%
Please attempt this question first.
Hints
Please attempt this question first.

Consider the following compounds:
a.  b. 
c.  d. 

Which option correctly ranks their boiling points from highest to lowest?
1. d > a > b > c 2. a > b > d >c
3. a > d > c > b 4. a > d > b > c
Subtopic:  Alcohols: Preparation & Properties |
 72%
Level 2: 60%+
Please attempt this question first.
Hints
Please attempt this question first.

advertisementadvertisement

Consider the following reactions:
(I) \(\mathrm{CH}_3-\mathrm{CH}=\mathrm{CH}_2 \xrightarrow[\text { (ii) } \mathrm{H}_2 \mathrm{O}_2 / \mathrm{OH}^{-}]{\text {(i) } \mathrm{B}_2 \mathrm{H}_6 / \text { THF }}(A)\)
(II) \(\mathrm{CH}_3-\mathrm{CH}=\mathrm{CH}_2 \xrightarrow{\mathrm{H}^{+} / \mathrm{H}_2 \mathrm{O}}(\mathrm{B})\)
Identify the major product(s) (A) and (B) formed in the above reactions.
1. 2.
3. 4.
Subtopic:  Alcohols: Preparation & Properties |
 85%
Level 1: 80%+
Please attempt this question first.
Hints
Please attempt this question first.

Complete the following chemical reactions and determine the major products labeled as A and B.
 
1.
2.
3.
4.
Subtopic:  Alcohols: Preparation & Properties |
 81%
Level 1: 80%+
Please attempt this question first.
Hints
Please attempt this question first.

Match the following compounds in List-I with their corresponding \(\mathrm{pK_a}\)​ values in List-II:
List-I (Compounds) List-II (\(\mathrm{pK_a}\))
(a) p-Nitrophenol (i) 10
(b) m-Nitrophenol (ii) 16
(c) Ethanol (iii) 7.1
(d) Phenol (iv) 8.3

1. (a)→(i); (b)→(ii); (c)→(iii); (d)→(iv)
2. (a)→(iii); (b)→(iv); (c)→(ii); (d)→(i)
3. (a)→(iv); (b)→(iii); (c)→(ii); (d)→(i)
4. (a)→(iii); (b)→(iv); (c)→(i); (d)→(ii)
Subtopic:  Alcohols: Preparation & Properties |
 68%
Level 2: 60%+
Please attempt this question first.
Hints
Please attempt this question first.

advertisementadvertisement

Consider the following reaction scheme:

The sum of the total number of oxygen atoms in B and C is:
1. 12 
2. 14 
3. 20 
4. 10
Subtopic:  Alcohols: Preparation & Properties |
Level 3: 35%-60%
Please attempt this question first.
Hints