Radioactive elements emit αβ , and γ rays and are characterized by their half-lives. The radioactive isotope of hydrogen is

1. Protium

2. Deuterium 

3. Tritium

4. Hydronium

Subtopic:  Hydrogen- Types & Isotopes |
 93%
Level 1: 80%+
Hints

Consider the reactions

(i) H2O2+2HII2+2H2O

(ii) HOCl+H2O2H3O++Cl-+O2

Which of the following statements is correct about H2O2 with reference to these reactions? Hydrogen peroxide is ______.

1.  an oxidising agent in both (i) and (ii)

2.  an oxidisng agent in (i) and reducing agent in (ii)

3.  a reducing agent in (i) and oxidising agent in (ii)

4.  a reducing agent in both (i) and (ii)

Subtopic:  H2O2 (Hydrogen Peroxide) |
 67%
Level 2: 60%+
Hints

The oxide that gives H2O2 on treatment with dilute H2SO4 is

1. PbO2

2. BaO2.8H2O+O2

3. MnO2

4. TiO2

Subtopic:  H2O2 (Hydrogen Peroxide) |
 83%
Level 1: 80%+
Hints

advertisementadvertisement

Which of the following equations depict the oxidising nature of H2O2?

1. 2MnO4-+6H++5H2O22Mn2++8H2O+5O2

2. 2Fe3++2H++H2O22Fe2++2H2O+O2

3. 2I-+2H++H2O2I2+2H2O

4. KIO4+H2O2KIO3+H2O+O2

Subtopic:  H2O2 (Hydrogen Peroxide) |
 74%
Level 2: 60%+
Hints

Which of the following equation depicts reducing nature of H2O2?

1. 2[Fe(CN)6]4-+2H++H2O22[Fe(CN)6]3-+2H2O

2.  I2+H2O2+2OH-2I-+2H2O+O2

3.  Mn2++H2O2Mn4++2OH-

4.  PbS+4H2O2PbSO4+4H2O

Subtopic:  H2O2 (Hydrogen Peroxide) |
 75%
Level 2: 60%+
Hints

Hydrogen peroxide is-

1. an oxidising agent

2. a reducing agent

3. both an oxidising and a reducing agent

4. neither oxidising nor reducing agent.

Subtopic:  H2O2 (Hydrogen Peroxide) |
 93%
Level 1: 80%+
Hints

advertisementadvertisement

Which of the following reactions increases production of dihydrogen from synthesis gas?

1. CH4(g)+H2O(g)Ni1270KCO(g)+3H2(g)

2. C(s)+H2O(g)1270KCO(g)+H2(g)

3. CO(g)+H2O(g)Catalyst673KCO2(g)+H2(g)

4. C2H6+2H2ONi1270K2CO+5H2

Subtopic:  Preparation & Properties |
 70%
Level 2: 60%+
Hints

When sodium peroxide is treated with dilute sulphuric acid, we get _____.

1. Sodium sulphate and water
2. Sodium sulphate and oxygen
3. Sodium sulphate, hydrogen and oxygen
4. Sodium sulphate and hydrogen peroxide

Subtopic:  H2O2 (Hydrogen Peroxide) |
 69%
Level 2: 60%+
Hints

Hydrogen peroxide is obtained by the electrolysis of ______.

1.  water

2.  sulphuric acid

3.  hydrochloric acid

4.  fused sodium peroxide

Subtopic:  Preparation & Properties |
 51%
Level 3: 35%-60%
Hints

advertisementadvertisement

Which of the following reactions is an example of use of water gas in the synthesis of other compounds?

1.  CH4(g)+H2O(g)Ni1270KCO(g)+H2(g)

2.  CO(g)+H2O(g)Catalyst673KCO2(g)+H2(g)

3.  CnH2n+2+nH2O(g)Ni1270KnCO+(2n+1)H2

4.  CO(g)+2H2(g)CatalystCobaltCH3OH(l)

Subtopic:  Water |
 55%
Level 3: 35%-60%
Hints