Which of the following reactions will give 2° chiral alcohol as one or more of major organic products?

(1) 
(2)
(3)
(4) None

निम्नलिखित में से कौन सी अभिक्रिया एक या अधिक प्रमुख कार्बनिक उत्पादों के रूप में 2° काइरल एल्कोहॉल देगी?

(1) 
(2)
(3)
(4) इनमे से कोई नहीं 

*excess - आधिक्य

Level 4: Below 35%

To unlock all the explanations of this course, you need to be enrolled.

Hints

The labelled -O18 will be in:

1. H2O

2. Methyl benzoate

3. Both (a) and (b)

4. Benzoic acid

Methyl benzonate- मिथाइल बेंजोएट

Catalyst- उत्प्रेरक

अंकित -O18 निम्न में होगा:

1. H2O

2. मेथिल बेंजोएट

3. (1) और (2) दोनों 

4. बेंजोइक अम्ल

Level 4: Below 35%

To unlock all the explanations of this course, you need to be enrolled.

Hints

Which of the following compounds give positive Tollen's Test?

       
1.        

2.      

3.        

4. 

निम्नलिखित में से कौन सा यौगिक सकारात्मक टॉलेन परीक्षण देता है?

1.        

2.      

3.        

4. 

Level 3: 35%-60%

To unlock all the explanations of this course, you need to be enrolled.

Hints

advertisementadvertisement

The major product of the following reaction is:

1. a hemiacetal                 

2. an acetal

3. an ether                       

4. an ester

 

निम्नलिखित अभिक्रिया का प्रमुख उत्पाद है:

Anhydous- निर्जल

(1) एक हेमीएसीटेल                        
(2) एक एसीटेल
(3) एक ईथर                               
(4) एक एस्टर

 

Level 4: Below 35%

To unlock all the explanations of this course, you need to be enrolled.

Hints

Succinic acid (A)NH3(B)KOHBr2(C); Product (C) will be:

1. CH2|-CO2HCH2-CH2-NH2

2. CH2|-CO2HCH2-NH2

3. CH2|-CO-2K+CH2-NH2

4. CH2|-CO2HCH2-CH2-Br

 

सक्सिनिक अम्ल (A)NH3(B)KOHBr2(C); उत्पाद (C) होगा:

1. CH2|-CO2HCH2-CH2-NH2

2. CH2|-CO2HCH2-NH2

3. CH2|-CO-2K+CH2-NH2

4. CH2|-CO2HCH2-CH2-Br

 

Level 4: Below 35%

To unlock all the explanations of this course, you need to be enrolled.

Hints

R-CH2-CH2OH can be converted into RCH2CH3COOH. The correct sequence of reagents is: 

1. PBr3, KCN, H

2. PBr3, KCN, H2     

3. KCN, H+

4. HCN, PBr3, H+

R-CH2-CH2OH को RCH2CH3COOH में रूपांतरित किया जा सकता है। अभिकर्मकों का सही अनुक्रम है:

1. PBr3, KCN, H

2. PBr3, KCN, H2     

3. KCN, H+

4. HCN, PBr3, H+

Level 4: Below 35%

To unlock all the explanations of this course, you need to be enrolled.

Hints

advertisementadvertisement

The reaction 

can be classified as

1. Alcohol formation reaction

2. Dehydration reaction

3. Williamson alcohol synthesis reaction

4. Williamson ether synthesis reaction

अभिक्रिया

को किस रूप में वर्गीकृत किया जा सकता है?

1. एल्कोहॉल निर्माण अभिक्रिया

2. निर्जलीकरण अभिक्रिया

3. विलियमसन एल्कोहॉल संश्लेषण अभिक्रिया

4. विलियमसन ईथर संश्लेषण अभिक्रिया

Level 4: Below 35%

To unlock all the explanations of this course, you need to be enrolled.

Hints

(CH3)3C-O-CH3 + HI Products, the product are

1. (CH3)3C-OH + CH3l

2. (CH3)3C-l + CH3OH

3. (CH3)3C-l + CH3l

4. (CH3)3C-OH + CH3OH

(CH3)3C-O-CH3 + HI उत्पाद, उत्पाद हैं:

1. (CH3)3C-OH + CH3l

2. (CH3)3C-l + CH3OH

3. (CH3)3C-l + CH3l

4. (CH3)3C-OH + CH3OH

Level 3: 35%-60%

To unlock all the explanations of this course, you need to be enrolled.

Hints

The main product of the following reaction is:

C6H5CH2CH(OH)CH(CH3)2Conc.H2SO4?

(1) 

(2) 

(3) 

(4)  

निम्नलिखित अभिक्रिया का मुख्य उत्पाद है:

C6H5CH2CH(OH)CH(CH3)2Conc.H2SO4?

(1) 

(2) 

(3) 

(4)  

 67%
Level 2: 60%+

To unlock all the explanations of this course, you need to be enrolled.

Hints

advertisementadvertisement

Which of the following compounds are not oxidized by HIO4?

1. 5,6,7     

2. 4,5,6,7     

3. 6,7     

4. 3,4,5,6,7

निम्नलिखित में से कौन सा यौगिक HIO4 द्वारा ऑक्सीकृत नहीं होता है?

1. 5,6,7     

2. 4,5,6,7     

3. 6,7     

4. 3,4,5,6,7

 57%
Level 3: 35%-60%

To unlock all the explanations of this course, you need to be enrolled.

Hints