Which of the following conditions is correct for a reversible reaction to be spontaneous, having both enthalpy change (ΔH) and entropy change (ΔS) positive, if Tₑ is the equilibrium temperature?

1. T = Te (reaction is at equilibrium condition)

2.  Te > T (equilibrium temperature is greater than reaction temperature)

3.  T > Te (reaction temperature is greater than equilibrium temperature)

4.  Te = 5T (equilibrium temperature is five times reaction temperature)

Subtopic:  Spontaneity & Entropy |
 70%
Level 2: 60%+
Please attempt this question first.
Hints
Please attempt this question first.

The standard enthalpy of formation of NH3 is –46 0. kJ mol−1. If the enthalpy of formation of H2 from its atoms is –436 kJ mol−1 and that of N2 is –712 kJ mol−1, the average bond enthalpy of N − H bond in NH3 is:

1. 1102kJmol1

2. 964kJmol1

3. +352kJmol1

4. +1056kJmol1

Subtopic:  Thermochemistry |
 60%
Level 2: 60%+
Please attempt this question first.
Hints
Please attempt this question first.

The value of enthalpy change (H) for the reaction

C2H5OH(1)+3O2(g)2CO2(g)+3H2O(l) at 27°C is -1366.5 kJ mol-1.

The value of internal energy change for the above reaction at this temperature will be:
1. –1369.0 k
2. –1364.0 kJ
3. –1361.5 k
4. 1371.5 kJ
Subtopic:  Enthalpy & Internal energy |
 73%
Level 2: 60%+
Please attempt this question first.
Hints
Please attempt this question first.

advertisementadvertisement

Consider the reaction:

ΔrH = –111 kJ

If N2O5(s) is formed instead of N2O5(g) in the above reaction, the rH value will be :
(Given: H of sublimation for N2O5 is 54 kJ mol1)

1. +54 kJ

2. + 219 kJ

3. –219 kJ

4. –165 kJ

Subtopic:  Hess's Law |
 57%
Level 3: 35%-60%
Please attempt this question first.
Hints
Please attempt this question first.

Find the standard enthalpy of formation of OH⁻(aq) at 25°C from the following data:

ΔfH°[H⁺(aq)] = 0

H₂O(l) → H⁺(aq) + OH⁻(aq)  ΔH° = +57.32 kJ mol⁻¹

H₂(g) + ½O₂(g) → H₂O(l)  ΔH° = –286.20 kJ mol⁻¹
 

1. –22.88 kJ

2. –228.88 kJ

3. +228.88 kJ

4. –343.52 kJ

Subtopic:  Gibbs Energy Change |
 81%
Level 1: 80%+
Please attempt this question first.
Hints

The oxidizing power of chlorine in an aqueous solution can be determined by the following parameters:

\(\small{\frac{1}{2} \left(Cl\right)_{2} \left(g\right) \overset{\frac{1}{2} \left(\Delta\right)_{diss} H^{\Theta}}{\longrightarrow} Cl \left(g\right) \overset{\left(\Delta\right)_{eg} H^{\Theta}}{\longrightarrow} \left(Cl\right)^{-} \left(g\right) \overset{\left(\Delta\right)_{hyd} H^{\Theta}}{\longrightarrow} \left(Cl\right)^{-} \left(aq\right)}\)

The energy involved in the conversion of \({ 1 \over 2}Cl_2(g)\) to \(Cl^-\)(aq) will be:
Use the following data:
\(\Delta_{\text {diss }} H^{\circ}\left(\mathrm{Cl}_2\right)=240 \mathrm{~kJ} \mathrm{~mol}^{-1}\)
\(\Delta_{\mathrm{eg}} H^{\circ}(\mathrm{Cl})=-349 \mathrm{~kJ} \mathrm{~mol}^{-1}\)
\(\Delta_{\mathrm{hyd}} H^{\circ}\left(\mathrm{Cl}^{-}\right)=-381 \mathrm{~kJ} \mathrm{~mol}^{-1}\)
 
1. - 610 kJ mol-1 2. - 850 kJ mol-1
3. +120 kJ mol-1 4. +152   kJ mol-1
Subtopic:  Hess's Law |
 85%
Level 1: 80%+
Please attempt this question first.
Hints
Please attempt this question first.

advertisementadvertisement

Standard entropy of X2, Y2 and XY3 are 60, 40 and 50 JK-1mol-1, respectively. For the reaction, 12X2+ 32Y2XY3H=-30kJ, to be at equilibrium, the temperature will be : 

1. 500 K

2. 750 K

3. 1000 K

4. 1250 K

Subtopic:  Spontaneity & Entropy |
 88%
Level 1: 80%+
Please attempt this question first.
Hints
Please attempt this question first.

Assuming that water vapor is an ideal gas, the internal energy change (∆U) when 1 mol of water is vaporized at 1 bar pressure and 100°C, will be:

(Given: Molar enthalpy of vaporization of water at 1 bar and 373 K = 41 kJ mol–1 and R = 8.3 J mol–1 K–1

1. 4.100 kJ mol–1

2. 3.7904 kJ mol–1

3. 37.904 kJ mol–1

4. 41.00 kJ mol–1

Subtopic:  Enthalpy & Internal energy |
 77%
Level 2: 60%+
Please attempt this question first.
Hints
Please attempt this question first.

Consider the following reaction for the conversion of limestone to lime:

CaCO3​(s)→CaO(s)+CO2​(g)

The values of ∆Hº and ∆Sº are +179.1 kJ/mol and 160.2 J/K, respectively, at 298 K and 1 bar. Assuming that ∆Hº and ∆Sº remain constant with temperature, calculate the temperature above which the conversion of limestone to lime will be spontaneous.

1. 1008 K 2. 1200 K
3. 845 K 4. 1118 K
Subtopic:  Enthalpy & Internal energy |
 63%
Level 2: 60%+
Please attempt this question first.
Hints
Please attempt this question first.

advertisementadvertisement

The entropy change involved in the isothermal reversible expansion of 2 moles of an ideal gas from a volume of 10 dm3 to a volume of 100 dm3 at 27º C is :

1. 38.3 J mol−1 K−1

2. 35.8 J mol−1 K−1

3. 32.3 J mol−1 K−1

4. 42.3  J mol−1 K−1 

Subtopic:  Spontaneity & Entropy |
 72%
Level 2: 60%+
Please attempt this question first.
Hints
Please attempt this question first.