ΔU is equal to:

1. Adiabatic work

2. Isothermal work

3. Isochoric work

4. Isobaric work

Subtopic:  First Law of Thermodynamics |
 85%
Level 1: 80%+
Please attempt this question first.
Hints
Please attempt this question first.

The incorrect expression among the following is :

\(\text { 1. In isothermal process, } \mathrm{W}_{\text {reversible }}=-\mathrm{nRT} \ln \frac{\mathrm{~V}_{\mathrm{f}}}{\mathrm{~V}_{\mathrm{i}}}\)
\(\text { 2. } \ln K=\frac{\Delta \mathrm{H}^{\circ}-\mathrm{T} \Delta \mathrm{~S}^{\circ}}{\mathrm{RT}}\)
\(\text { 3. } \mathrm{K}=\mathrm{e}^{-\Delta \mathrm{G}^{\circ} / \mathrm{RT}}\)
\(\text { 4. } \frac{\Delta \mathrm{G}_{\text {system }}}{\Delta \mathrm{S}_{\text {total }}}=-\mathrm{T}\)

Subtopic:  Spontaneity & Entropy | Gibbs Energy Change |
 58%
Level 3: 35%-60%
Please attempt this question first.
Hints
Please attempt this question first.

For complete combustion of ethanol, C2H5OH(l) + 3O2(g) → 2 CO2(g) + 3H2O(l) , the amount of heat produced as measured in a bomb calorimeter, is 1364.47 kJ mol–1 at 25ºC. Assuming ideality the enthalpy of combustion, ∆CH, for the reaction will be: (R = 8.314 J K–1 mol–1)

1.  – 1361.95 kJ mol–1

2.  – 1460.50 kJ mol–1

3.  – 1350.50 kJ mol–1

4.  – 1366.95 kJ mol–1

Subtopic:  Enthalpy & Internal energy |
 59%
Level 3: 35%-60%
Please attempt this question first.
Hints
Please attempt this question first.

advertisementadvertisement

The entropy change involved in the isothermal reversible expansion of 2 moles of an ideal gas from a volume of 10 dm3 to a volume of 100 dm3 at 27º C is :

1. 38.3 J mol−1 K−1

2. 35.8 J mol−1 K−1

3. 32.3 J mol−1 K−1

4. 42.3  J mol−1 K−1 

Subtopic:  Spontaneity & Entropy |
 72%
Level 2: 60%+
Please attempt this question first.
Hints
Please attempt this question first.

Which of the following conditions is correct for a reversible reaction to be spontaneous, having both enthalpy change (ΔH) and entropy change (ΔS) positive, if Tₑ is the equilibrium temperature?

1. T = Te (reaction is at equilibrium condition)

2.  Te > T (equilibrium temperature is greater than reaction temperature)

3.  T > Te (reaction temperature is greater than equilibrium temperature)

4.  Te = 5T (equilibrium temperature is five times reaction temperature)

Subtopic:  Spontaneity & Entropy |
 70%
Level 2: 60%+
Please attempt this question first.
Hints
Please attempt this question first.

The standard enthalpy of formation of NH3 is –46 0. kJ mol−1. If the enthalpy of formation of H2 from its atoms is –436 kJ mol−1 and that of N2 is –712 kJ mol−1, the average bond enthalpy of N − H bond in NH3 is:

1. 1102kJmol1

2. 964kJmol1

3. +352kJmol1

4. +1056kJmol1

Subtopic:  Thermochemistry |
 60%
Level 2: 60%+
Please attempt this question first.
Hints
Please attempt this question first.

advertisementadvertisement

The value of enthalpy change (H) for the reaction

C2H5OH(1)+3O2(g)2CO2(g)+3H2O(l) at 27°C is -1366.5 kJ mol-1.

The value of internal energy change for the above reaction at this temperature will be:
1. –1369.0 k
2. –1364.0 kJ
3. –1361.5 k
4. 1371.5 kJ
Subtopic:  Enthalpy & Internal energy |
 73%
Level 2: 60%+
Please attempt this question first.
Hints
Please attempt this question first.

Consider the reaction:

ΔrH = –111 kJ

If N2O5(s) is formed instead of N2O5(g) in the above reaction, the rH value will be :
(Given: H of sublimation for N2O5 is 54 kJ mol1)

1. +54 kJ

2. + 219 kJ

3. –219 kJ

4. –165 kJ

Subtopic:  Hess's Law |
 57%
Level 3: 35%-60%
Please attempt this question first.
Hints
Please attempt this question first.

Find the standard enthalpy of formation of OH⁻(aq) at 25°C from the following data:

ΔfH°[H⁺(aq)] = 0

H₂O(l) → H⁺(aq) + OH⁻(aq)  ΔH° = +57.32 kJ mol⁻¹

H₂(g) + ½O₂(g) → H₂O(l)  ΔH° = –286.20 kJ mol⁻¹
 

1. –22.88 kJ

2. –228.88 kJ

3. +228.88 kJ

4. –343.52 kJ

Subtopic:  Gibbs Energy Change |
 81%
Level 1: 80%+
Please attempt this question first.
Hints

advertisementadvertisement

The oxidizing power of chlorine in an aqueous solution can be determined by the following parameters:

\(\small{\frac{1}{2} \left(Cl\right)_{2} \left(g\right) \overset{\frac{1}{2} \left(\Delta\right)_{diss} H^{\Theta}}{\longrightarrow} Cl \left(g\right) \overset{\left(\Delta\right)_{eg} H^{\Theta}}{\longrightarrow} \left(Cl\right)^{-} \left(g\right) \overset{\left(\Delta\right)_{hyd} H^{\Theta}}{\longrightarrow} \left(Cl\right)^{-} \left(aq\right)}\)

The energy involved in the conversion of \({ 1 \over 2}Cl_2(g)\) to \(Cl^-\)(aq) will be:
Use the following data:
\(\Delta_{\text {diss }} H^{\circ}\left(\mathrm{Cl}_2\right)=240 \mathrm{~kJ} \mathrm{~mol}^{-1}\)
\(\Delta_{\mathrm{eg}} H^{\circ}(\mathrm{Cl})=-349 \mathrm{~kJ} \mathrm{~mol}^{-1}\)
\(\Delta_{\mathrm{hyd}} H^{\circ}\left(\mathrm{Cl}^{-}\right)=-381 \mathrm{~kJ} \mathrm{~mol}^{-1}\)
 
1. - 610 kJ mol-1 2. - 850 kJ mol-1
3. +120 kJ mol-1 4. +152   kJ mol-1
Subtopic:  Hess's Law |
 85%
Level 1: 80%+
Please attempt this question first.
Hints
Please attempt this question first.