Assertion: Boron always forms a covalent bond.

Reason: Boron has a diagonal relationship with silicon.

1. Both Assertion & Reason are true and the reason is the correct explanation of the assertion.
2. Both Assertion & Reason are true but the reason is not the correct explanation of the assertion.
3. Assertion is a true statement but Reason is false.
4. Both Assertion and Reason are false statements.

Subtopic:  Compounds of Boron- Preparations, Properties & Uses |
 62%
Level 2: 60%+
Hints

Assertion: B-X bond length in BX3 is shorter than the expected value.

Reason: pπ- back bonding occurs between B and X.

1. Both Assertion & Reason are true and the reason is the correct explanation of the assertion.
2. Both Assertion & Reason are true but the reason is not the correct explanation of the assertion.
3. Assertion is a true statement but Reason is false.
4. Both Assertion and Reason are false statements.

Subtopic:  Compounds of Boron- Preparations, Properties & Uses |
 86%
Level 1: 80%+
Hints

Assertion: The total number of coordinate bonds and covalent bonds in borazine is 3 and 12 respectively.

Reason: Its structure is similar to benzene.

1. Both Assertion & Reason are true and the reason is the correct explanation of the assertion.

2. Both Assertion & Reason are true but the reason is not the correct explanation of the assertion.

3. Assertion is a true statement but Reason is false.

4. Both Assertion and Reason are false statements.

Subtopic:  Boron Family- Preparations, Properties & Uses |
 55%
Level 3: 35%-60%
Hints
Links

advertisementadvertisement

White fumes appear around the bottle of anhydrous AlCl3. This is due to :

1. Formation of Al(OH)3

2. Dimerisation of AlCl3

3. Hydrolysis of AlCl3 gives HCl gas

4. Adsorption of moisture 

Subtopic:  Boron Family- Preparations, Properties & Uses |
 76%
Level 2: 60%+
Hints

The element among the following that does not show the inert pair effect is:

1. Al

2. Sn

3. Pb

4. Tl

Subtopic:  Boron Family- Preparations, Properties & Uses |
 88%
Level 1: 80%+
Please attempt this question first.
Hints
Please attempt this question first.

H3BO3 is -

1. A Monobasic acid and a weak Lewis acid.

2. A Monobasic and a weak Bronsted acid..

3. A Monobasic and a strong Lewis acid.

4. A Tribasic and a weak Bronsted acid.

Subtopic:  Compounds of Boron- Preparations, Properties & Uses |
 76%
Level 2: 60%+
Hints
Links

advertisementadvertisement

The most characteristic oxidation state for lead and tin is, respectively,:

1. +4, +2

2. +2, +4

3. +4, +4

4. +2, +2

Subtopic:  Properties of Glass, Pb & Sn compounds |
 78%
Level 2: 60%+
AIPMT - 2007
Hints
Links

An anion present in the chain structure silicate is -

1. Si2O76-

2. (Si2O52-)n

3. (SiO32-)n

4. SiO44-

Subtopic:  Properties of Structure of SiO2 & Other Compounds |
Level 3: 35%-60%
AIPMT - 2007
Hints
Links

B2H6 can't be prepared by -

1. NaBH4  + I2 

2. BF3  + NaH 

3. B3N3H6  + H2O 

4. Mg3B2 + dil HCl

Subtopic:  Compounds of Boron- Preparations, Properties & Uses |
Level 3: 35%-60%
Hints

advertisementadvertisement

Na2B4O710H2O740C2NaBO2+(X)+10H2O
(X)+CaF2+H2SO4Y+CaSO4+H2O
(Y)+NaBH4(Z)+NaBF4

Select the incorrect statement regarding compounds (X), (Y) and (Z).

1.  Compound (X) is B2O3 and compound (Z) contains two 3C - 2e bonds

2.  Compound (X) is B2O3 and compound (Y) contains one 3C - 2e bonds 

3.  Compound (Y) is Lewis acid and stable due to pπ-pπ back bonding

4.  Compound (Z) reacts with excess of NH3 at high temperature gives inorganic graphite 

Subtopic:  Compounds of Boron- Preparations, Properties & Uses |
Level 3: 35%-60%
Hints